C5H8N4 — CID 123415128
5-ethenyl-3-methyl-1,2,4-triazol-1-amine (PubChem CID 123415128) has the molecular formula C5H8N4 and a molecular weight of 124.15 g/mol. Its IUPAC name is 5-ethenyl-3-methyl-1,2,4-triazol-1-amine.
| Compound Name | 5-ethenyl-3-methyl-1,2,4-triazol-1-amine |
|---|---|
| PubChem CID | 123415128 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 5-ethenyl-3-methyl-1,2,4-triazol-1-amine |
| SMILES | C=Cc1nc(C)nn1N |
| InChI | InChI=1S/C5H8N4/c1-3-5-7-4(2)8-9(5)6/h3H,1,6H2,2H3 |
| InChIKey | BPRRSHJSLBJPIZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |