C5H5N3W2 — CID 58904784
3-ethenyl-5-methyl-1,2-diaza-4-azanidacyclopenta-2,5-diene;tungsten;tungsten(2+) (PubChem CID 58904784) has the molecular formula C5H5N3W2 and a molecular weight of 474.80 g/mol. Its IUPAC name is 3-ethenyl-5-methyl-1,2-diaza-4-azanidacyclopenta-2,5-diene;tungsten;tungsten(2+).
| Compound Name | 3-ethenyl-5-methyl-1,2-diaza-4-azanidacyclopenta-2,5-diene;tungsten;tungsten(2+) |
|---|---|
| PubChem CID | 58904784 |
| Molecular Formula | C5H5N3W2 |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | 3-ethenyl-5-methyl-1,2-diaza-4-azanidacyclopenta-2,5-diene;tungsten;tungsten(2+) |
| SMILES | [H]/[C-]=C/c1nnc(C)[n-]1.[W+2].[W] |
| InChI | InChI=1S/C5H5N3.2W/c1-3-5-6-4(2)7-8-5;;/h1,3H,2H3;;/q-2;;+2 |
| InChIKey | DSVDFQVQDKOIRM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|