C6H9N3 — CID 143191750
5-ethenyl-1,3-dimethyl-1,2,4-triazole (PubChem CID 143191750) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 5-ethenyl-1,3-dimethyl-1,2,4-triazole.
| Compound Name | 5-ethenyl-1,3-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143191750 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 5-ethenyl-1,3-dimethyl-1,2,4-triazole |
| SMILES | C=Cc1nc(C)nn1C |
| InChI | InChI=1S/C6H9N3/c1-4-6-7-5(2)8-9(6)3/h4H,1H2,2-3H3 |
| InChIKey | XQTVLBPNXWKENT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |