C7H10BF3N3- — CID 106746356
3-(3,5-dimethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746356) has the molecular formula C7H10BF3N3- and a molecular weight of 203.98 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746356 |
| Molecular Formula | C7H10BF3N3- |
| Molecular Weight | 203.98 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1nc(C)nc1C)[B-](F)(F)F |
| InChI | InChI=1S/C7H10BF3N3/c1-5(8(9,10)11)4-14-7(3)12-6(2)13-14/h1,4H2,2-3H3/q-1 |
| InChIKey | RUGZTSCBQAZOET-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.98 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|