C5H8BF3N3- — CID 63704673
(3,5-dimethyl-1,2,4-triazol-1-yl)methyl-trifluoroboranuide (PubChem CID 63704673) has the molecular formula C5H8BF3N3- and a molecular weight of 177.95 g/mol. Its IUPAC name is (3,5-dimethyl-1,2,4-triazol-1-yl)methyl-trifluoroboranuide.
| Compound Name | (3,5-dimethyl-1,2,4-triazol-1-yl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63704673 |
| Molecular Formula | C5H8BF3N3- |
| Molecular Weight | 177.95 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3,5-dimethyl-1,2,4-triazol-1-yl)methyl-trifluoroboranuide |
| SMILES | Cc1nc(C)n(C[B-](F)(F)F)n1 |
| InChI | InChI=1S/C5H8BF3N3/c1-4-10-5(2)12(11-4)3-6(7,8)9/h3H2,1-2H3/q-1 |
| InChIKey | IIQCYIMDMJJCKJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.95 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|