About 2,5-dimethyl-1,2,4-triazole-3-carbonitrile
2,5-dimethyl-1,2,4-triazole-3-carbonitrile (PubChem CID 82650970) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 2,5-dimethyl-1,2,4-triazole-3-carbonitrile.
Analyze 2,5-dimethyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 2,5-dimethyl-1,2,4-triazole-3-carbonitrile (CID 82650970) is 2,5-dimethyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 2,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 2,5-dimethyl-1,2,4-triazole-3-carbonitrile is Cc1nc(C#N)n(C)n1.
What is the InChIKey of 2,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is XTILBDYDMYYBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-4-7-5(3-6)9(2)8-4/h1-2H3.
What are the key properties of 2,5-dimethyl-1,2,4-triazole-3-carbonitrile?
2,5-dimethyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 122.13 g/mol, XLogP of -0.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 82650970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).