C5H9N3 — CID 573470
3,4,5-trimethyl-1,2,4-triazole (PubChem CID 573470) has the molecular formula C5H9N3 and a molecular weight of 111.15 g/mol. Its IUPAC name is 3,4,5-trimethyl-1,2,4-triazole.
| Compound Name | 3,4,5-trimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 573470 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 3,4,5-trimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(C)n1C |
| InChI | InChI=1S/C5H9N3/c1-4-6-7-5(2)8(4)3/h1-3H3 |
| InChIKey | LPZFPHRTKOOKLX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |