C5H6N4 — CID 59872479
2-(1-methyl-1,2,4-triazol-3-yl)acetonitrile (PubChem CID 59872479) has the molecular formula C5H6N4 and a molecular weight of 122.13 g/mol. Its IUPAC name is 2-(1-methyl-1,2,4-triazol-3-yl)acetonitrile.
| Compound Name | 2-(1-methyl-1,2,4-triazol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 59872479 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2-(1-methyl-1,2,4-triazol-3-yl)acetonitrile |
| SMILES | Cn1cnc(CC#N)n1 |
| InChI | InChI=1S/C5H6N4/c1-9-4-7-5(8-9)2-3-6/h4H,2H2,1H3 |
| InChIKey | FYSZHICVIHIJDF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |