About 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile
5-amino-1-methyl-1,2,4-triazole-3-carbonitrile (PubChem CID 121313892) has the molecular formula C4H5N5
and a molecular weight of 123.12 g/mol. Its IUPAC name is 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile.
Analyze 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile (CID 121313892) is 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile is Cn1nc(C#N)nc1N.
What is the InChIKey of 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is XIYLDPNSVOXTGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5/c1-9-4(6)7-3(2-5)8-9/h1H3,(H2,6,7,8).
What are the key properties of 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile?
5-amino-1-methyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 123.12 g/mol, XLogP of -0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-methyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 121313892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).