C9H14BF3N3- — CID 106746426
3-(3,5-diethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746426) has the molecular formula C9H14BF3N3- and a molecular weight of 232.04 g/mol. Its IUPAC name is 3-(3,5-diethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(3,5-diethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746426 |
| Molecular Formula | C9H14BF3N3- |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(3,5-diethyl-1,2,4-triazol-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1nc(CC)nc1CC)[B-](F)(F)F |
| InChI | InChI=1S/C9H14BF3N3/c1-4-8-14-9(5-2)16(15-8)6-7(3)10(11,12)13/h3-6H2,1-2H3/q-1 |
| InChIKey | MSTDHYSSHLWCJC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|