About 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole
5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole (PubChem CID 163439948) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole.
Analyze 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole?
The IUPAC name of 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole (CID 163439948) is 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole.
What is the SMILES notation for 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole?
The canonical SMILES for 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole is C/C=C(/C)c1nc(C)nn1C.
What is the InChIKey of 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole?
The InChIKey is AXRCWQKBJBPDOM-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H13N3/c1-5-6(2)8-9-7(3)10-11(8)4/h5H,1-4H3/b6-5-.
What are the key properties of 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole?
5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole has a molecular weight of 151.21 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-2-en-2-yl]-1,3-dimethyl-1,2,4-triazole is sourced from PubChem (CID 163439948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).