C11H15FN4 — CID 156790868
(2Z)-4-fluoro-N-methyl-1-(5-propan-2-yl-1,2,4-triazol-1-yl)penta-2,4-dien-1-imine (PubChem CID 156790868) has the molecular formula C11H15FN4 and a molecular weight of 222.27 g/mol. Its IUPAC name is (2Z)-4-fluoro-N-methyl-1-(5-propan-2-yl-1,2,4-triazol-1-yl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-4-fluoro-N-methyl-1-(5-propan-2-yl-1,2,4-triazol-1-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 156790868 |
| Molecular Formula | C11H15FN4 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2Z)-4-fluoro-N-methyl-1-(5-propan-2-yl-1,2,4-triazol-1-yl)penta-2,4-dien-1-imine |
| SMILES | C=C(F)/C=C\C(=N\C)n1ncnc1C(C)C |
| InChI | InChI=1S/C11H15FN4/c1-8(2)11-14-7-15-16(11)10(13-4)6-5-9(3)12/h5-8H,3H2,1-2,4H3/b6-5-,13-10- |
| InChIKey | AEYSMHCWJZRJBN-MUIHLJEFSA-N |
| XLogP | 2.32 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|