C11H14N4 — CID 123229456
2-ethyl-5-hexa-2,4-dien-2-yl-1,2,4-triazole-3-carbonitrile (PubChem CID 123229456) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-ethyl-5-hexa-2,4-dien-2-yl-1,2,4-triazole-3-carbonitrile.
| Compound Name | 2-ethyl-5-hexa-2,4-dien-2-yl-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 123229456 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-ethyl-5-hexa-2,4-dien-2-yl-1,2,4-triazole-3-carbonitrile |
| SMILES | CC=CC=C(C)c1nc(C#N)n(CC)n1 |
| InChI | InChI=1S/C11H14N4/c1-4-6-7-9(3)11-13-10(8-12)15(5-2)14-11/h4,6-7H,5H2,1-3H3 |
| InChIKey | ATMODIKSFSPJND-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|