C7H10N4 — CID 163874071
N-(3-ethenyl-5-ethyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 163874071) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is N-(3-ethenyl-5-ethyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | N-(3-ethenyl-5-ethyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 163874071 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-(3-ethenyl-5-ethyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | C=Cc1nnc(CC)n1N=C |
| InChI | InChI=1S/C7H10N4/c1-4-6-9-10-7(5-2)11(6)8-3/h4H,1,3,5H2,2H3 |
| InChIKey | PNIAQRSMVAIHQJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|