C11H20N4 — CID 143479693
ethane;(Z)-N-(3-ethenyl-5-methyl-1,2,4-triazol-4-yl)butan-2-imine (PubChem CID 143479693) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is ethane;(Z)-N-(3-ethenyl-5-methyl-1,2,4-triazol-4-yl)butan-2-imine.
| Compound Name | ethane;(Z)-N-(3-ethenyl-5-methyl-1,2,4-triazol-4-yl)butan-2-imine |
|---|---|
| PubChem CID | 143479693 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | ethane;(Z)-N-(3-ethenyl-5-methyl-1,2,4-triazol-4-yl)butan-2-imine |
| SMILES | C=Cc1nnc(C)n1/N=C(/C)CC.CC |
| InChI | InChI=1S/C9H14N4.C2H6/c1-5-7(3)12-13-8(4)10-11-9(13)6-2;1-2/h6H,2,5H2,1,3-4H3;1-2H3/b12-7-; |
| InChIKey | XGWSGRHCPOFWBN-OZLKFZLXSA-N |
| XLogP | 2.89 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|