C9H14IN3 — CID 169098136
5-ethenyl-1-iodo-3-pentyl-1,2,4-triazole (PubChem CID 169098136) has the molecular formula C9H14IN3 and a molecular weight of 291.14 g/mol. Its IUPAC name is 5-ethenyl-1-iodo-3-pentyl-1,2,4-triazole.
| Compound Name | 5-ethenyl-1-iodo-3-pentyl-1,2,4-triazole |
|---|---|
| PubChem CID | 169098136 |
| Molecular Formula | C9H14IN3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-ethenyl-1-iodo-3-pentyl-1,2,4-triazole |
| SMILES | C=Cc1nc(CCCCC)nn1I |
| InChI | InChI=1S/C9H14IN3/c1-3-5-6-7-8-11-9(4-2)13(10)12-8/h4H,2-3,5-7H2,1H3 |
| InChIKey | QCARVXIVWIOYBU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|