C10H15N5 — CID 123330850
N,N-dimethyl-5-[(2E)-1-methyliminopenta-2,4-dien-2-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 123330850) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is N,N-dimethyl-5-[(2E)-1-methyliminopenta-2,4-dien-2-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | N,N-dimethyl-5-[(2E)-1-methyliminopenta-2,4-dien-2-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123330850 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N,N-dimethyl-5-[(2E)-1-methyliminopenta-2,4-dien-2-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | C=C/C=C(\C=N\C)c1nc(N(C)C)n[nH]1 |
| InChI | InChI=1S/C10H15N5/c1-5-6-8(7-11-2)9-12-10(14-13-9)15(3)4/h5-7H,1H2,2-4H3,(H,12,13,14)/b8-6+,11-7+ |
| InChIKey | BTABCMQXQOPYBQ-JMFBPXTISA-N |
| XLogP | 1.14 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|