C8H10N4 — CID 141395353
1-methyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine (PubChem CID 141395353) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 1-methyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine.
| Compound Name | 1-methyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine |
|---|---|
| PubChem CID | 141395353 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-methyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine |
| SMILES | CN1C=CC(c2ncn[nH]2)=CC1 |
| InChI | InChI=1S/C8H10N4/c1-12-4-2-7(3-5-12)8-9-6-10-11-8/h2-4,6H,5H2,1H3,(H,9,10,11) |
| InChIKey | GVBYVQTUYSUZJP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |