About 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole
5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole (PubChem CID 123560741) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole.
Analyze 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole?
The IUPAC name of 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole (CID 123560741) is 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole.
What is the SMILES notation for 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole?
The canonical SMILES for 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole is C1=CC=CC=C(c2ncn[nH]2)C=1.
What is the InChIKey of 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole?
The InChIKey is KWKIOHQFGLNKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3/c1-2-4-6-8(5-3-1)9-10-7-11-12-9/h1-3,5-7H,(H,10,11,12).
What are the key properties of 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole?
5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole has a molecular weight of 157.18 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohepta-1,3,5,6-tetraen-1-yl-1H-1,2,4-triazole is sourced from PubChem (CID 123560741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).