C9H12N4 — CID 141395362
1-ethyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine (PubChem CID 141395362) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-ethyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine.
| Compound Name | 1-ethyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine |
|---|---|
| PubChem CID | 141395362 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-ethyl-4-(1H-1,2,4-triazol-5-yl)-2H-pyridine |
| SMILES | CCN1C=CC(c2ncn[nH]2)=CC1 |
| InChI | InChI=1S/C9H12N4/c1-2-13-5-3-8(4-6-13)9-10-7-11-12-9/h3-5,7H,2,6H2,1H3,(H,10,11,12) |
| InChIKey | PQWUBEAHHWUIAY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |