C18H20N4W — CID 59252450
1,2,3,4,5-pentamethylbenzene-6-ide;5-(1H-1,2,4-triazol-5-yl)-2H-pyridin-2-ide;tungsten(2+) (PubChem CID 59252450) has the molecular formula C18H20N4W and a molecular weight of 476.23 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylbenzene-6-ide;5-(1H-1,2,4-triazol-5-yl)-2H-pyridin-2-ide;tungsten(2+).
| Compound Name | 1,2,3,4,5-pentamethylbenzene-6-ide;5-(1H-1,2,4-triazol-5-yl)-2H-pyridin-2-ide;tungsten(2+) |
|---|---|
| PubChem CID | 59252450 |
| Molecular Formula | C18H20N4W |
| Molecular Weight | 476.23 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1,2,3,4,5-pentamethylbenzene-6-ide;5-(1H-1,2,4-triazol-5-yl)-2H-pyridin-2-ide;tungsten(2+) |
| SMILES | Cc1[c-]c(C)c(C)c(C)c1C.[W+2].[c-]1ccc(-c2ncn[nH]2)cn1 |
| InChI | InChI=1S/C11H15.C7H5N4.W/c1-7-6-8(2)10(4)11(5)9(7)3;1-2-6(4-8-3-1)7-9-5-10-11-7;/h1-5H3;1-2,4-5H,(H,9,10,11);/q2*-1;+2 |
| InChIKey | OSTPFEKYXQNFRK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|