C11H17N3 — CID 144523472
ethane;5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-1,2,4-triazole (PubChem CID 144523472) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-1,2,4-triazole.
| Compound Name | ethane;5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 144523472 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1H-1,2,4-triazole |
| SMILES | C=C/C(=C\C=C/C)c1ncn[nH]1.CC |
| InChI | InChI=1S/C9H11N3.C2H6/c1-3-5-6-8(4-2)9-10-7-11-12-9;1-2/h3-7H,2H2,1H3,(H,10,11,12);1-2H3/b5-3-,8-6+; |
| InChIKey | UMFARUJZURAFKK-MQASBHRKSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|