C14H23N3 — CID 143413768
ethane;(3Z,5Z)-4-methylocta-1,3,5,7-tetraene;5-methyl-1H-1,2,4-triazole (PubChem CID 143413768) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-methylocta-1,3,5,7-tetraene;5-methyl-1H-1,2,4-triazole.
| Compound Name | ethane;(3Z,5Z)-4-methylocta-1,3,5,7-tetraene;5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 143413768 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | ethane;(3Z,5Z)-4-methylocta-1,3,5,7-tetraene;5-methyl-1H-1,2,4-triazole |
| SMILES | C=C/C=C\C(C)=C/C=C.CC.Cc1ncn[nH]1 |
| InChI | InChI=1S/C9H12.C3H5N3.C2H6/c1-4-6-8-9(3)7-5-2;1-3-4-2-5-6-3;1-2/h4-8H,1-2H2,3H3;2H,1H3,(H,4,5,6);1-2H3/b8-6-,9-7-;; |
| InChIKey | IEIMZKZAVFUCIG-SGBPTPMJSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|