C15H24N4 — CID 143200385
4-(5-heptyl-1H-1,2,4-triazol-3-yl)-1-methyl-2H-pyridine (PubChem CID 143200385) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-(5-heptyl-1H-1,2,4-triazol-3-yl)-1-methyl-2H-pyridine.
| Compound Name | 4-(5-heptyl-1H-1,2,4-triazol-3-yl)-1-methyl-2H-pyridine |
|---|---|
| PubChem CID | 143200385 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4-(5-heptyl-1H-1,2,4-triazol-3-yl)-1-methyl-2H-pyridine |
| SMILES | CCCCCCCc1nc(C2=CCN(C)C=C2)n[nH]1 |
| InChI | InChI=1S/C15H24N4/c1-3-4-5-6-7-8-14-16-15(18-17-14)13-9-11-19(2)12-10-13/h9-11H,3-8,12H2,1-2H3,(H,16,17,18) |
| InChIKey | IFYMQAQGXSDAKW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|