C9H12N4 — CID 143913725
(2E)-N-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)penta-2,4-dien-1-imine (PubChem CID 143913725) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2E)-N-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-N-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143913725 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (2E)-N-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C9H12N4/c1-4-5-8(6-10-3)9-11-7(2)12-13-9/h4-6H,1H2,2-3H3,(H,11,12,13)/b8-5+,10-6+ |
| InChIKey | HUGJGEHZQVXSJX-YLDLMLGBSA-N |
| XLogP | 1.38 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|