C19H16F3NO3 — CID 135979827
methyl 6-[2-[2-hydroxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]pyridine-2-carboxylate (PubChem CID 135979827) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is methyl 6-[2-[2-hydroxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[2-[2-hydroxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135979827 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 6-[2-[2-hydroxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C2=C(c3cc(C(F)(F)F)ccc3O)CCC2)n1 |
| InChI | InChI=1S/C19H16F3NO3/c1-26-18(25)16-7-3-6-15(23-16)13-5-2-4-12(13)14-10-11(19(20,21)22)8-9-17(14)24/h3,6-10,24H,2,4-5H2,1H3 |
| InChIKey | RNYJNEPHUFWIAI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |