C18H16FNO3 — CID 143033766
fluoro 6-[2-(2-methoxyphenyl)cyclopenten-1-yl]pyridine-2-carboxylate (PubChem CID 143033766) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is fluoro 6-[2-(2-methoxyphenyl)cyclopenten-1-yl]pyridine-2-carboxylate.
| Compound Name | fluoro 6-[2-(2-methoxyphenyl)cyclopenten-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143033766 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | fluoro 6-[2-(2-methoxyphenyl)cyclopenten-1-yl]pyridine-2-carboxylate |
| SMILES | COc1ccccc1C1=C(c2cccc(C(=O)OF)n2)CCC1 |
| InChI | InChI=1S/C18H16FNO3/c1-22-17-11-3-2-6-14(17)12-7-4-8-13(12)15-9-5-10-16(20-15)18(21)23-19/h2-3,5-6,9-11H,4,7-8H2,1H3 |
| InChIKey | SSSVOVHSRNRZGA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |