C28H29NO2 — CID 143033845
ethyl 6-[2-[2-[2-(4-methylphenyl)ethyl]phenyl]cyclopenten-1-yl]pyridine-2-carboxylate (PubChem CID 143033845) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is ethyl 6-[2-[2-[2-(4-methylphenyl)ethyl]phenyl]cyclopenten-1-yl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-[2-[2-(4-methylphenyl)ethyl]phenyl]cyclopenten-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143033845 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | ethyl 6-[2-[2-[2-(4-methylphenyl)ethyl]phenyl]cyclopenten-1-yl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(C2=C(c3ccccc3CCc3ccc(C)cc3)CCC2)n1 |
| InChI | InChI=1S/C28H29NO2/c1-3-31-28(30)27-13-7-12-26(29-27)25-11-6-10-24(25)23-9-5-4-8-22(23)19-18-21-16-14-20(2)15-17-21/h4-5,7-9,12-17H,3,6,10-11,18-19H2,1-2H3 |
| InChIKey | MWTLNRLALROHGD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |