C13H9F2N3OS — CID 135981614
2-[(2,3-difluoroanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135981614) has the molecular formula C13H9F2N3OS and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(2,3-difluoroanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(2,3-difluoroanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135981614 |
| Molecular Formula | C13H9F2N3OS |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(2,3-difluoroanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNc2cccc(F)c2F)nc2ccsc12 |
| InChI | InChI=1S/C13H9F2N3OS/c14-7-2-1-3-8(11(7)15)16-6-10-17-9-4-5-20-12(9)13(19)18-10/h1-5,16H,6H2,(H,17,18,19) |
| InChIKey | MNKPHKHCPDMMIE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |