C14H12BrN3OS — CID 136692928
2-[(3-bromo-5-methylanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136692928) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-[(3-bromo-5-methylanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(3-bromo-5-methylanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136692928 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-[(3-bromo-5-methylanilino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cc(Br)cc(NCc2nc3ccsc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H12BrN3OS/c1-8-4-9(15)6-10(5-8)16-7-12-17-11-2-3-20-13(11)14(19)18-12/h2-6,16H,7H2,1H3,(H,17,18,19) |
| InChIKey | SWBCTOYSYAKWPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |