About 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one
2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 160547415) has the molecular formula C18H18BrClN2OS
and a molecular weight of 425.78 g/mol. Its IUPAC name is 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 160547415 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCCCc2cc(Cl)cc(Br)c2)nc2ccsc12 |
| InChI | InChI=1S/C18H18BrClN2OS/c19-13-9-12(10-14(20)11-13)5-3-1-2-4-6-16-21-15-7-8-24-17(15)18(23)22-16/h7-11H,1-6H2,(H,21,22,23) |
| InChIKey | RXYNATTZPHTAPR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one (CID 160547415) is 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one is O=c1[nH]c(CCCCCCc2cc(Cl)cc(Br)c2)nc2ccsc12.
What is the InChIKey of 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The InChIKey is RXYNATTZPHTAPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrClN2OS/c19-13-9-12(10-14(20)11-13)5-3-1-2-4-6-16-21-15-7-8-24-17(15)18(23)22-16/h7-11H,1-6H2,(H,21,22,23).
What are the key properties of 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one?
2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one has a molecular weight of 425.78 g/mol, XLogP of 5.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 160547415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).