C18H18BrClN2OS — CID 160547415
2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 160547415) has the molecular formula C18H18BrClN2OS and a molecular weight of 425.78 g/mol. Its IUPAC name is 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 160547415 |
| Molecular Formula | C18H18BrClN2OS |
| Molecular Weight | 425.78 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 2-[6-(3-bromo-5-chlorophenyl)hexyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCCCc2cc(Cl)cc(Br)c2)nc2ccsc12 |
| InChI | InChI=1S/C18H18BrClN2OS/c19-13-9-12(10-14(20)11-13)5-3-1-2-4-6-16-21-15-7-8-24-17(15)18(23)22-16/h7-11H,1-6H2,(H,21,22,23) |
| InChIKey | RXYNATTZPHTAPR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|