C20H23ClN4OS — CID 155558563
2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 155558563) has the molecular formula C20H23ClN4OS and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155558563 |
| Molecular Formula | C20H23ClN4OS |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCN2CCN(c3cccc(Cl)c3)CC2)nc2ccsc12 |
| InChI | InChI=1S/C20H23ClN4OS/c21-15-4-3-5-16(14-15)25-11-9-24(10-12-25)8-2-1-6-18-22-17-7-13-27-19(17)20(26)23-18/h3-5,7,13-14H,1-2,6,8-12H2,(H,22,23,26) |
| InChIKey | LALWPGAEPPZUHO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|