C25H30ClN7O2S — CID 22423976
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide (PubChem CID 22423976) has the molecular formula C25H30ClN7O2S and a molecular weight of 528.08 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
|---|---|
| PubChem CID | 22423976 |
| Molecular Formula | C25H30ClN7O2S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
| SMILES | Cn1c(=O)c2sccc2n2c(CCCC(=O)NCCCN3CCN(c4cccc(Cl)c4)CC3)nnc12 |
| InChI | InChI=1S/C25H30ClN7O2S/c1-30-24(35)23-20(9-16-36-23)33-21(28-29-25(30)33)7-3-8-22(34)27-10-4-11-31-12-14-32(15-13-31)19-6-2-5-18(26)17-19/h2,5-6,9,16-17H,3-4,7-8,10-15H2,1H3,(H,27,34) |
| InChIKey | ASVAPFAYGDAIHK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|