C20H21N5O3S — CID 20904562
N-[(4-methoxyphenyl)methyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide (PubChem CID 20904562) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
|---|---|
| PubChem CID | 20904562 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)butanamide |
| SMILES | COc1ccc(CNC(=O)CCCc2nnc3n(C)c(=O)c4sccc4n23)cc1 |
| InChI | InChI=1S/C20H21N5O3S/c1-24-19(27)18-15(10-11-29-18)25-16(22-23-20(24)25)4-3-5-17(26)21-12-13-6-8-14(28-2)9-7-13/h6-11H,3-5,12H2,1-2H3,(H,21,26) |
| InChIKey | LTQCDNGPFFWLBH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |