C19H19N5O2S2 — CID 7184636
4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(3-methylsulfanylphenyl)butanamide (PubChem CID 7184636) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(3-methylsulfanylphenyl)butanamide.
| Compound Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(3-methylsulfanylphenyl)butanamide |
|---|---|
| PubChem CID | 7184636 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(3-methylsulfanylphenyl)butanamide |
| SMILES | CSc1cccc(NC(=O)CCCc2nnc3n(C)c(=O)c4sccc4n23)c1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-23-18(26)17-14(9-10-28-17)24-15(21-22-19(23)24)7-4-8-16(25)20-12-5-3-6-13(11-12)27-2/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,20,25) |
| InChIKey | JXYKGQOLPDLPMC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |