C19H16F3N5O2S — CID 20904546
4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 20904546) has the molecular formula C19H16F3N5O2S and a molecular weight of 435.43 g/mol. Its IUPAC name is 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 20904546 |
| Molecular Formula | C19H16F3N5O2S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cn1c(=O)c2sccc2n2c(CCCC(=O)Nc3cccc(C(F)(F)F)c3)nnc12 |
| InChI | InChI=1S/C19H16F3N5O2S/c1-26-17(29)16-13(8-9-30-16)27-14(24-25-18(26)27)6-3-7-15(28)23-12-5-2-4-11(10-12)19(20,21)22/h2,4-5,8-10H,3,6-7H2,1H3,(H,23,28) |
| InChIKey | UVEMWTHCUBXACQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |