C21H26N6O4S-2 — CID 161022065
azane;methanediolate;4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(2-phenylethyl)butanamide (PubChem CID 161022065) has the molecular formula C21H26N6O4S-2 and a molecular weight of 458.54 g/mol. Its IUPAC name is azane;methanediolate;4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(2-phenylethyl)butanamide.
| Compound Name | azane;methanediolate;4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 161022065 |
| Molecular Formula | C21H26N6O4S-2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | azane;methanediolate;4-(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-(2-phenylethyl)butanamide |
| SMILES | Cn1c(=O)c2sccc2n2c(CCCC(=O)NCCc3ccccc3)nnc12.N.[O-]C[O-] |
| InChI | InChI=1S/C20H21N5O2S.CH2O2.H3N/c1-24-19(27)18-15(11-13-28-18)25-16(22-23-20(24)25)8-5-9-17(26)21-12-10-14-6-3-2-4-7-14;2-1-3;/h2-4,6-7,11,13H,5,8-10,12H2,1H3,(H,21,26);1H2;1H3/q;-2; |
| InChIKey | CKUYTLIHTGRYLX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|