C23H24N6O2S — CID 20904665
4-(8-ethyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[2-(1H-indol-3-yl)ethyl]butanamide (PubChem CID 20904665) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-(8-ethyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[2-(1H-indol-3-yl)ethyl]butanamide.
| Compound Name | 4-(8-ethyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[2-(1H-indol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 20904665 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-(8-ethyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)-N-[2-(1H-indol-3-yl)ethyl]butanamide |
| SMILES | CCn1c(=O)c2sccc2n2c(CCCC(=O)NCCc3c[nH]c4ccccc34)nnc12 |
| InChI | InChI=1S/C23H24N6O2S/c1-2-28-22(31)21-18(11-13-32-21)29-19(26-27-23(28)29)8-5-9-20(30)24-12-10-15-14-25-17-7-4-3-6-16(15)17/h3-4,6-7,11,13-14,25H,2,5,8-10,12H2,1H3,(H,24,30) |
| InChIKey | LDFUFCKOBASEJZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |