C23H30N4OS — CID 118728510
5,6-dimethyl-2-[5-(4-phenylpiperazin-1-yl)pentyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 118728510) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is 5,6-dimethyl-2-[5-(4-phenylpiperazin-1-yl)pentyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[5-(4-phenylpiperazin-1-yl)pentyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 118728510 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5,6-dimethyl-2-[5-(4-phenylpiperazin-1-yl)pentyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CCCCCN3CCN(c4ccccc4)CC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C23H30N4OS/c1-17-18(2)29-23-21(17)22(28)24-20(25-23)11-7-4-8-12-26-13-15-27(16-14-26)19-9-5-3-6-10-19/h3,5-6,9-10H,4,7-8,11-16H2,1-2H3,(H,24,25,28) |
| InChIKey | WAVPQRDHOFHTLY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|