C25H33N3OS — CID 118728512
2-[5-(4-benzylpiperidin-1-yl)pentyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 118728512) has the molecular formula C25H33N3OS and a molecular weight of 423.63 g/mol. Its IUPAC name is 2-[5-(4-benzylpiperidin-1-yl)pentyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[5-(4-benzylpiperidin-1-yl)pentyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 118728512 |
| Molecular Formula | C25H33N3OS |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-[5-(4-benzylpiperidin-1-yl)pentyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CCCCCN3CCC(Cc4ccccc4)CC3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C25H33N3OS/c1-18-19(2)30-25-23(18)24(29)26-22(27-25)11-7-4-8-14-28-15-12-21(13-16-28)17-20-9-5-3-6-10-20/h3,5-6,9-10,21H,4,7-8,11-17H2,1-2H3,(H,26,27,29) |
| InChIKey | SGQOVLUMNHAQHS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|