C23H26N6O — CID 160748550
2-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-3H-quinazolin-4-one (PubChem CID 160748550) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 160748550 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CCCCN2CCN(c3n[nH]c4ccccc34)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H26N6O/c30-23-18-8-2-3-9-19(18)24-21(25-23)11-5-6-12-28-13-15-29(16-14-28)22-17-7-1-4-10-20(17)26-27-22/h1-4,7-10H,5-6,11-16H2,(H,26,27)(H,24,25,30) |
| InChIKey | RWMXQOIYWHPCNJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|