C19H27N5OS — CID 70340905
3-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-5-methyl-1,3-thiazolidin-2-one (PubChem CID 70340905) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 3-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-5-methyl-1,3-thiazolidin-2-one.
| Compound Name | 3-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-5-methyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 70340905 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-[4-[4-(1H-indazol-3-yl)piperazin-1-yl]butyl]-5-methyl-1,3-thiazolidin-2-one |
| SMILES | CC1CN(CCCCN2CCN(c3n[nH]c4ccccc34)CC2)C(=O)S1 |
| InChI | InChI=1S/C19H27N5OS/c1-15-14-24(19(25)26-15)9-5-4-8-22-10-12-23(13-11-22)18-16-6-2-3-7-17(16)20-21-18/h2-3,6-7,15H,4-5,8-14H2,1H3,(H,20,21) |
| InChIKey | PIRFOACZUZYQPY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|