C14H11N3O3S — CID 135799401
2-[(1,3-benzodioxol-5-ylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135799401) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[(1,3-benzodioxol-5-ylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(1,3-benzodioxol-5-ylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135799401 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[(1,3-benzodioxol-5-ylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNc2ccc3c(c2)OCO3)nc2ccsc12 |
| InChI | InChI=1S/C14H11N3O3S/c18-14-13-9(3-4-21-13)16-12(17-14)6-15-8-1-2-10-11(5-8)20-7-19-10/h1-5,15H,6-7H2,(H,16,17,18) |
| InChIKey | DHOXXSURHPTBFF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|