C25H22N8O2 — CID 135982171
4-[[(8-ethynyl-3,4-dihydro-2H-chromen-6-yl)-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide (PubChem CID 135982171) has the molecular formula C25H22N8O2 and a molecular weight of 466.51 g/mol. Its IUPAC name is 4-[[(8-ethynyl-3,4-dihydro-2H-chromen-6-yl)-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[(8-ethynyl-3,4-dihydro-2H-chromen-6-yl)-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 135982171 |
| Molecular Formula | C25H22N8O2 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-[[(8-ethynyl-3,4-dihydro-2H-chromen-6-yl)-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)methyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(c2cc(C#C)c3c(c2)CCCO3)c2nn(-c3ncccn3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H22N8O2/c1-2-15-13-18(14-17-5-3-12-35-21(15)17)20(30-19-8-6-16(7-9-19)22(26)27)23-31-25(34)33(32-23)24-28-10-4-11-29-24/h1,4,6-11,13-14,20,30H,3,5,12H2,(H3,26,27)(H,31,32,34) |
| InChIKey | VPYQEPPIQBAGMN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|