C27H28FN7O6 — CID 143547849
4-[[(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-[1-(3-formyl-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]benzenecarboximidamide;methanol (PubChem CID 143547849) has the molecular formula C27H28FN7O6 and a molecular weight of 565.56 g/mol. Its IUPAC name is 4-[[(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-[1-(3-formyl-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]benzenecarboximidamide;methanol.
| Compound Name | 4-[[(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-[1-(3-formyl-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]benzenecarboximidamide;methanol |
|---|---|
| PubChem CID | 143547849 |
| Molecular Formula | C27H28FN7O6 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 4-[[(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-[1-(3-formyl-2-pyridinyl)-5-oxo-4H-1,2,4-triazol-3-yl]methyl]amino]benzenecarboximidamide;methanol |
| SMILES | CO.[H]/N=C(\N)c1ccc(NC(c2nn(-c3ncccc3C=O)c(=O)[nH]2)c2cc(OC)c3c(c2F)OCCCO3)cc1 |
| InChI | InChI=1S/C26H24FN7O5.CH4O/c1-37-18-12-17(19(27)22-21(18)38-10-3-11-39-22)20(31-16-7-5-14(6-8-16)23(28)29)24-32-26(36)34(33-24)25-15(13-35)4-2-9-30-25;1-2/h2,4-9,12-13,20,31H,3,10-11H2,1H3,(H3,28,29)(H,32,33,36);2H,1H3 |
| InChIKey | ZQWJOLJSZWLDBF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 190.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|