C40H42FeN10O12 — CID 135983866
bis(ethyl 5-[(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron (PubChem CID 135983866) has the molecular formula C40H42FeN10O12 and a molecular weight of 910.68 g/mol. Its IUPAC name is bis(ethyl 5-[(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron.
| Compound Name | bis(ethyl 5-[(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron |
|---|---|
| PubChem CID | 135983866 |
| Molecular Formula | C40H42FeN10O12 |
| Molecular Weight | 910.68 g/mol |
| Exact Mass | 910.23 |
| IUPAC Name | bis(ethyl 5-[(2-hydroxy-4-oxo-1,5-dioxaspiro[5.5]undec-2-en-3-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate);iron |
| SMILES | CCOC(=O)c1cnn(-c2ccccn2)c1/N=N/C1=C(O)OC2(CCCCC2)OC1=O.CCOC(=O)c1cnn(-c2ccccn2)c1/N=N\C1=C(O)OC2(CCCCC2)OC1=O.[Fe] |
| InChI | InChI=1S/2C20H21N5O6.Fe/c2*1-2-29-17(26)13-12-22-25(14-8-4-7-11-21-14)16(13)24-23-15-18(27)30-20(31-19(15)28)9-5-3-6-10-20;/h2*4,7-8,11-12,27H,2-3,5-6,9-10H2,1H3;/b24-23+;24-23-; |
| InChIKey | UMPSCMMURVTXFS-QFMGKEMUSA-N |
| XLogP | 6.97 |
| TPSA | 274.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|