C38H42CuN10O12 — CID 135983867
copper;bis(ethyl 5-[(4-hydroxy-2-methyl-6-oxo-2-propyl-1,3-dioxin-5-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate) (PubChem CID 135983867) has the molecular formula C38H42CuN10O12 and a molecular weight of 894.36 g/mol. Its IUPAC name is copper;bis(ethyl 5-[(4-hydroxy-2-methyl-6-oxo-2-propyl-1,3-dioxin-5-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate).
| Compound Name | copper;bis(ethyl 5-[(4-hydroxy-2-methyl-6-oxo-2-propyl-1,3-dioxin-5-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate) |
|---|---|
| PubChem CID | 135983867 |
| Molecular Formula | C38H42CuN10O12 |
| Molecular Weight | 894.36 g/mol |
| Exact Mass | 893.23 |
| IUPAC Name | copper;bis(ethyl 5-[(4-hydroxy-2-methyl-6-oxo-2-propyl-1,3-dioxin-5-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate) |
| SMILES | CCCC1(C)OC(=O)C(/N=N/c2c(C(=O)OCC)cnn2-c2ccccn2)=C(O)O1.CCCC1(C)OC(=O)C(/N=N\c2c(C(=O)OCC)cnn2-c2ccccn2)=C(O)O1.[Cu] |
| InChI | InChI=1S/2C19H21N5O6.Cu/c2*1-4-9-19(3)29-17(26)14(18(27)30-19)22-23-15-12(16(25)28-5-2)11-21-24(15)13-8-6-7-10-20-13;/h2*6-8,10-11,26H,4-5,9H2,1-3H3;/b23-22+;23-22-; |
| InChIKey | OGILNLBZWWRDOM-DHNDPJIRSA-N |
| XLogP | 6.69 |
| TPSA | 274.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.36 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|