C26H35N9O2 — CID 135983883
ethyl 5-[(6-tert-butyl-3-heptan-3-yl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 135983883) has the molecular formula C26H35N9O2 and a molecular weight of 505.63 g/mol. Its IUPAC name is ethyl 5-[(6-tert-butyl-3-heptan-3-yl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(6-tert-butyl-3-heptan-3-yl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135983883 |
| Molecular Formula | C26H35N9O2 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | ethyl 5-[(6-tert-butyl-3-heptan-3-yl-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CCCCC(CC)c1nnc2c(/N=N/c3c(C(=O)OCC)cnn3-c3ccccn3)c(C(C)(C)C)[nH]n12 |
| InChI | InChI=1S/C26H35N9O2/c1-7-10-13-17(8-2)22-30-32-24-20(21(26(4,5)6)33-35(22)24)29-31-23-18(25(36)37-9-3)16-28-34(23)19-14-11-12-15-27-19/h11-12,14-17,33H,7-10,13H2,1-6H3/b31-29+ |
| InChIKey | NTKBXVLOPZCSCD-OWWNRXNESA-N |
| XLogP | 6.21 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|