C21H23N5O3 — CID 135983869
ethyl 5-[(5-tert-butyl-2-hydroxyphenyl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 135983869) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is ethyl 5-[(5-tert-butyl-2-hydroxyphenyl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(5-tert-butyl-2-hydroxyphenyl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135983869 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl 5-[(5-tert-butyl-2-hydroxyphenyl)diazenyl]-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccn2)c1/N=N/c1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C21H23N5O3/c1-5-29-20(28)15-13-23-26(18-8-6-7-11-22-18)19(15)25-24-16-12-14(21(2,3)4)9-10-17(16)27/h6-13,27H,5H2,1-4H3/b25-24+ |
| InChIKey | VAQHROGEHWAWAE-OCOZRVBESA-N |
| XLogP | 4.86 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|