C19H18N4O3 — CID 55629523
[2-(N-methylanilino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 55629523) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55629523 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 5-methyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N(C)c2ccccc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C19H18N4O3/c1-14-16(12-21-23(14)17-10-6-7-11-20-17)19(25)26-13-18(24)22(2)15-8-4-3-5-9-15/h3-12H,13H2,1-2H3 |
| InChIKey | WTMFZXZMFHBFLY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |